C34H39N3O4 — CID 57052852
tert-butyl 3-[[3,3-dimethyl-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]carbamoyl]-6-(4-phenylphenyl)hex-5-ynoate (PubChem CID 57052852) has the molecular formula C34H39N3O4 and a molecular weight of 553.70 g/mol. Its IUPAC name is tert-butyl 3-[[3,3-dimethyl-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]carbamoyl]-6-(4-phenylphenyl)hex-5-ynoate.
| Compound Name | tert-butyl 3-[[3,3-dimethyl-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]carbamoyl]-6-(4-phenylphenyl)hex-5-ynoate |
|---|---|
| PubChem CID | 57052852 |
| Molecular Formula | C34H39N3O4 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | tert-butyl 3-[[3,3-dimethyl-1-oxo-1-(pyridin-2-ylamino)butan-2-yl]carbamoyl]-6-(4-phenylphenyl)hex-5-ynoate |
| SMILES | CC(C)(C)OC(=O)CC(CC#Cc1ccc(-c2ccccc2)cc1)C(=O)NC(C(=O)Nc1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C34H39N3O4/c1-33(2,3)30(32(40)36-28-17-10-11-22-35-28)37-31(39)27(23-29(38)41-34(4,5)6)16-12-13-24-18-20-26(21-19-24)25-14-8-7-9-15-25/h7-11,14-15,17-22,27,30H,16,23H2,1-6H3,(H,37,39)(H,35,36,40) |
| InChIKey | IGMPTHAXWARNSR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|