C13H19N5O — CID 57053090
1-carbamimidoyl-3-prop-2-enyl-1-(3-pyridin-4-ylpropyl)urea (PubChem CID 57053090) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 1-carbamimidoyl-3-prop-2-enyl-1-(3-pyridin-4-ylpropyl)urea.
| Compound Name | 1-carbamimidoyl-3-prop-2-enyl-1-(3-pyridin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 57053090 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-carbamimidoyl-3-prop-2-enyl-1-(3-pyridin-4-ylpropyl)urea |
| SMILES | [H]/N=C(\N)N(CCCc1ccncc1)C(=O)NCC=C |
| InChI | InChI=1S/C13H19N5O/c1-2-7-17-13(19)18(12(14)15)10-3-4-11-5-8-16-9-6-11/h2,5-6,8-9H,1,3-4,7,10H2,(H3,14,15)(H,17,19) |
| InChIKey | IFGWKPVWDXSVSV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|