C12H12N4OS — CID 57053503
4-cyano-N-(2-ethyl-2,3-dihydro-1,3,4-thiadiazol-5-yl)benzamide (PubChem CID 57053503) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 4-cyano-N-(2-ethyl-2,3-dihydro-1,3,4-thiadiazol-5-yl)benzamide.
| Compound Name | 4-cyano-N-(2-ethyl-2,3-dihydro-1,3,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 57053503 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 4-cyano-N-(2-ethyl-2,3-dihydro-1,3,4-thiadiazol-5-yl)benzamide |
| SMILES | CCC1NN=C(NC(=O)c2ccc(C#N)cc2)S1 |
| InChI | InChI=1S/C12H12N4OS/c1-2-10-15-16-12(18-10)14-11(17)9-5-3-8(7-13)4-6-9/h3-6,10,15H,2H2,1H3,(H,14,16,17) |
| InChIKey | RHKAPWKSAPFUTN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |