C24H28N2O4S — CID 57059260
[[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-methoxymethyl] 4-methylbenzenesulfonate (PubChem CID 57059260) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is [[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-methoxymethyl] 4-methylbenzenesulfonate.
| Compound Name | [[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-methoxymethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57059260 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [[(6aR,9R)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-methoxymethyl] 4-methylbenzenesulfonate |
| SMILES | COC(OS(=O)(=O)c1ccc(C)cc1)[C@@H]1CC2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C24H28N2O4S/c1-15-7-9-18(10-8-15)31(27,28)30-24(29-3)17-11-20-19-5-4-6-21-23(19)16(13-25-21)12-22(20)26(2)14-17/h4-10,13,17,20,22,24-25H,11-12,14H2,1-3H3/t17-,20?,22-,24?/m1/s1 |
| InChIKey | RGBZMOIEEIFXBK-LKNFMUQFSA-N |
| XLogP | 3.81 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|