C21H24N4OS — CID 70485101
2-[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-2-(3-methyl-1,2-thiazol-5-yl)acetamide (PubChem CID 70485101) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 2-[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-2-(3-methyl-1,2-thiazol-5-yl)acetamide.
| Compound Name | 2-[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-2-(3-methyl-1,2-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 70485101 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-2-(3-methyl-1,2-thiazol-5-yl)acetamide |
| SMILES | Cc1cc(C(C(N)=O)C2C[C@@H]3c4cccc5[nH]cc(c45)C[C@H]3N(C)C2)sn1 |
| InChI | InChI=1S/C21H24N4OS/c1-11-6-18(27-24-11)20(21(22)26)13-7-15-14-4-3-5-16-19(14)12(9-23-16)8-17(15)25(2)10-13/h3-6,9,13,15,17,20,23H,7-8,10H2,1-2H3,(H2,22,26)/t13?,15-,17-,20?/m1/s1 |
| InChIKey | ZSDZFYQNBPLHTA-BXUYSKSPSA-N |
| XLogP | 3.16 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |