C20H22N4OS — CID 70485463
(6aR,10aR)-7-methyl-N-(3-methyl-1,2-thiazol-5-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 70485463) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is (6aR,10aR)-7-methyl-N-(3-methyl-1,2-thiazol-5-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,10aR)-7-methyl-N-(3-methyl-1,2-thiazol-5-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 70485463 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (6aR,10aR)-7-methyl-N-(3-methyl-1,2-thiazol-5-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | Cc1cc(NC(=O)C2C[C@@H]3c4cccc5[nH]cc(c45)C[C@H]3N(C)C2)sn1 |
| InChI | InChI=1S/C20H22N4OS/c1-11-6-18(26-23-11)22-20(25)13-7-15-14-4-3-5-16-19(14)12(9-21-16)8-17(15)24(2)10-13/h3-6,9,13,15,17,21H,7-8,10H2,1-2H3,(H,22,25)/t13?,15-,17-/m1/s1 |
| InChIKey | YFUOAHPOOWUAGM-RJPUVWTNSA-N |
| XLogP | 3.53 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |