C19H20N4OS — CID 88701423
(6aR,9S)-7-methyl-N-(1,3-thiazol-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 88701423) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is (6aR,9S)-7-methyl-N-(1,3-thiazol-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9S)-7-methyl-N-(1,3-thiazol-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 88701423 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (6aR,9S)-7-methyl-N-(1,3-thiazol-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CN1C[C@@H](C(=O)Nc2nccs2)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C19H20N4OS/c1-23-10-12(18(24)22-19-20-5-6-25-19)7-14-13-3-2-4-15-17(13)11(9-21-15)8-16(14)23/h2-6,9,12,14,16,21H,7-8,10H2,1H3,(H,20,22,24)/t12-,14?,16+/m0/s1 |
| InChIKey | FARIHHBFWQQJLW-RAAOQPIXSA-N |
| XLogP | 3.22 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |