C21H24N4OS — CID 56992882
3-[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 56992882) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 3-[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 56992882 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-[(6aR,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CN1CC(CCC(=O)Nc2nccs2)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C21H24N4OS/c1-25-12-13(5-6-19(26)24-21-22-7-8-27-21)9-16-15-3-2-4-17-20(15)14(11-23-17)10-18(16)25/h2-4,7-8,11,13,16,18,23H,5-6,9-10,12H2,1H3,(H,22,24,26)/t13?,16-,18-/m1/s1 |
| InChIKey | MNFXKPZQRKTWLK-FMRBYIFOSA-N |
| XLogP | 4.00 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |