C20H21N5O2 — CID 57257896
(6aR,9R)-7-methyl-N-(4-oxidopyrazin-4-ium-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 57257896) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is (6aR,9R)-7-methyl-N-(4-oxidopyrazin-4-ium-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-7-methyl-N-(4-oxidopyrazin-4-ium-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 57257896 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (6aR,9R)-7-methyl-N-(4-oxidopyrazin-4-ium-2-yl)-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CN1C[C@H](C(=O)Nc2c[n+]([O-])ccn2)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C20H21N5O2/c1-24-10-13(20(26)23-18-11-25(27)6-5-21-18)7-15-14-3-2-4-16-19(14)12(9-22-16)8-17(15)24/h2-6,9,11,13,15,17,22H,7-8,10H2,1H3,(H,21,23,26)/t13-,15?,17-/m1/s1 |
| InChIKey | CRXFXJUCOSVCOA-GWHNWCKOSA-N |
| XLogP | 1.79 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|