C9H9NO4S — CID 57059439
7-oxo-3-(3-sulfanylidenepropylidene)-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 57059439) has the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. Its IUPAC name is 7-oxo-3-(3-sulfanylidenepropylidene)-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | 7-oxo-3-(3-sulfanylidenepropylidene)-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 57059439 |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 7-oxo-3-(3-sulfanylidenepropylidene)-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1C(=CCC=S)OC2CC(=O)N21 |
| InChI | InChI=1S/C9H9NO4S/c11-6-4-7-10(6)8(9(12)13)5(14-7)2-1-3-15/h2-3,7-8H,1,4H2,(H,12,13) |
| InChIKey | QLAQWPIBFJWNRD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|