C11H13NO7 — CID 67036142
5-[(5R)-2-carboxyoxy-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene]pentanoic acid (PubChem CID 67036142) has the molecular formula C11H13NO7 and a molecular weight of 271.22 g/mol. Its IUPAC name is 5-[(5R)-2-carboxyoxy-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene]pentanoic acid.
| Compound Name | 5-[(5R)-2-carboxyoxy-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 67036142 |
| Molecular Formula | C11H13NO7 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 5-[(5R)-2-carboxyoxy-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene]pentanoic acid |
| SMILES | O=C(O)CCCC=C1O[C@@H]2CC(=O)N2C1OC(=O)O |
| InChI | InChI=1S/C11H13NO7/c13-7-5-8-12(7)10(19-11(16)17)6(18-8)3-1-2-4-9(14)15/h3,8,10H,1-2,4-5H2,(H,14,15)(H,16,17)/t8-,10?/m1/s1 |
| InChIKey | NZTGVBABGQWHAN-HNHGDDPOSA-N |
| XLogP | 0.73 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|