C12H13NO7 — CID 118158337
2-[(5R)-2-methoxycarbonyloxy-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene]pent-4-enoic acid (PubChem CID 118158337) has the molecular formula C12H13NO7 and a molecular weight of 283.24 g/mol. Its IUPAC name is 2-[(5R)-2-methoxycarbonyloxy-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene]pent-4-enoic acid.
| Compound Name | 2-[(5R)-2-methoxycarbonyloxy-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene]pent-4-enoic acid |
|---|---|
| PubChem CID | 118158337 |
| Molecular Formula | C12H13NO7 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-[(5R)-2-methoxycarbonyloxy-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-3-ylidene]pent-4-enoic acid |
| SMILES | C=CCC(C(=O)O)=C1O[C@@H]2CC(=O)N2C1OC(=O)OC |
| InChI | InChI=1S/C12H13NO7/c1-3-4-6(11(15)16)9-10(20-12(17)18-2)13-7(14)5-8(13)19-9/h3,8,10H,1,4-5H2,2H3,(H,15,16)/t8-,10?/m1/s1 |
| InChIKey | MKXYMJVZEXUDLM-HNHGDDPOSA-N |
| XLogP | 0.60 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|