C19H18BrNO6 — CID 87244101
benzyl [(5R)-3-(6-bromo-1-oxohex-4-en-2-ylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-2-yl] carbonate (PubChem CID 87244101) has the molecular formula C19H18BrNO6 and a molecular weight of 436.26 g/mol. Its IUPAC name is benzyl [(5R)-3-(6-bromo-1-oxohex-4-en-2-ylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-2-yl] carbonate.
| Compound Name | benzyl [(5R)-3-(6-bromo-1-oxohex-4-en-2-ylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-2-yl] carbonate |
|---|---|
| PubChem CID | 87244101 |
| Molecular Formula | C19H18BrNO6 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | benzyl [(5R)-3-(6-bromo-1-oxohex-4-en-2-ylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptan-2-yl] carbonate |
| SMILES | O=CC(CC=CCBr)=C1O[C@@H]2CC(=O)N2C1OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18BrNO6/c20-9-5-4-8-14(11-22)17-18(21-15(23)10-16(21)26-17)27-19(24)25-12-13-6-2-1-3-7-13/h1-7,11,16,18H,8-10,12H2/t16-,18?/m1/s1 |
| InChIKey | FBFWSNMAWMGYSX-PYUWXLGESA-N |
| XLogP | 3.05 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|