C8H11NO3 — CID 72538450
3-(methoxymethylidene)-2-methyl-4-oxa-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 72538450) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 3-(methoxymethylidene)-2-methyl-4-oxa-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | 3-(methoxymethylidene)-2-methyl-4-oxa-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 72538450 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 3-(methoxymethylidene)-2-methyl-4-oxa-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | COC=C1OC2CC(=O)N2C1C |
| InChI | InChI=1S/C8H11NO3/c1-5-6(4-11-2)12-8-3-7(10)9(5)8/h4-5,8H,3H2,1-2H3 |
| InChIKey | IVLDZVDEEAACRJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|