C18H22O2 — CID 174780810
5-(6-phenyl-2-bicyclo[2.2.1]heptanylidene)pentanoic acid (PubChem CID 174780810) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 5-(6-phenyl-2-bicyclo[2.2.1]heptanylidene)pentanoic acid.
| Compound Name | 5-(6-phenyl-2-bicyclo[2.2.1]heptanylidene)pentanoic acid |
|---|---|
| PubChem CID | 174780810 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 5-(6-phenyl-2-bicyclo[2.2.1]heptanylidene)pentanoic acid |
| SMILES | O=C(O)CCCC=C1CC2CC1C(c1ccccc1)C2 |
| InChI | InChI=1S/C18H22O2/c19-18(20)9-5-4-8-15-10-13-11-16(17(15)12-13)14-6-2-1-3-7-14/h1-3,6-8,13,16-17H,4-5,9-12H2,(H,19,20) |
| InChIKey | GQKGZANBTMAWKI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|