C12H20O4 — CID 57059945
2,2,4,6,6-pentamethyl-3,5-dioxoheptanoic acid (PubChem CID 57059945) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2,2,4,6,6-pentamethyl-3,5-dioxoheptanoic acid.
| Compound Name | 2,2,4,6,6-pentamethyl-3,5-dioxoheptanoic acid |
|---|---|
| PubChem CID | 57059945 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2,2,4,6,6-pentamethyl-3,5-dioxoheptanoic acid |
| SMILES | CC(C(=O)C(C)(C)C)C(=O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H20O4/c1-7(8(13)11(2,3)4)9(14)12(5,6)10(15)16/h7H,1-6H3,(H,15,16) |
| InChIKey | WMNHLPNABSAQSE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|