C29H27ClN2O2 — CID 57060373
[6-[[4-[(3-chlorophenyl)-phenylmethyl]pyrazol-1-yl]methyl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate (PubChem CID 57060373) has the molecular formula C29H27ClN2O2 and a molecular weight of 471.00 g/mol. Its IUPAC name is [6-[[4-[(3-chlorophenyl)-phenylmethyl]pyrazol-1-yl]methyl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate.
| Compound Name | [6-[[4-[(3-chlorophenyl)-phenylmethyl]pyrazol-1-yl]methyl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 57060373 |
| Molecular Formula | C29H27ClN2O2 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [6-[[4-[(3-chlorophenyl)-phenylmethyl]pyrazol-1-yl]methyl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1CCC(Cn1cc(C(c3ccccc3)c3cccc(Cl)c3)cn1)C2 |
| InChI | InChI=1S/C29H27ClN2O2/c1-20(33)34-28-12-6-9-23-15-21(13-14-27(23)28)18-32-19-25(17-31-32)29(22-7-3-2-4-8-22)24-10-5-11-26(30)16-24/h2-12,16-17,19,21,29H,13-15,18H2,1H3 |
| InChIKey | VOSNYTVWBRZLPZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|