C28H28N2O5 — CID 22101781
[(Z)-(1-amino-2,2-diphenylethylidene)amino] 2-(5-acetylperoxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate (PubChem CID 22101781) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is [(Z)-(1-amino-2,2-diphenylethylidene)amino] 2-(5-acetylperoxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate.
| Compound Name | [(Z)-(1-amino-2,2-diphenylethylidene)amino] 2-(5-acetylperoxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate |
|---|---|
| PubChem CID | 22101781 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [(Z)-(1-amino-2,2-diphenylethylidene)amino] 2-(5-acetylperoxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate |
| SMILES | CC(=O)OOc1cccc2c1CCC(CC(=O)O/N=C(\N)C(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C28H28N2O5/c1-19(31)34-35-25-14-8-13-23-17-20(15-16-24(23)25)18-26(32)33-30-28(29)27(21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-14,20,27H,15-18H2,1H3,(H2,29,30) |
| InChIKey | HDVQNFVMHCQRJH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|