C30H32N2O5 — CID 57083680
2-[[5-[3-[(1-amino-2,2-diphenylethylidene)amino]oxy-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]propanoic acid (PubChem CID 57083680) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[[5-[3-[(1-amino-2,2-diphenylethylidene)amino]oxy-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]propanoic acid.
| Compound Name | 2-[[5-[3-[(1-amino-2,2-diphenylethylidene)amino]oxy-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 57083680 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 2-[[5-[3-[(1-amino-2,2-diphenylethylidene)amino]oxy-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]propanoic acid |
| SMILES | CC(Oc1cccc2c1CCCC2CCC(=O)ON=C(N)C(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H32N2O5/c1-20(30(34)35)36-26-17-9-15-24-21(14-8-16-25(24)26)18-19-27(33)37-32-29(31)28(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-7,9-13,15,17,20-21,28H,8,14,16,18-19H2,1H3,(H2,31,32)(H,34,35) |
| InChIKey | HIRZVIVBYYWAEW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|