C28H28N2O4 — CID 57034459
[5-[3-amino-2-(benzhydrylideneamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate (PubChem CID 57034459) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is [5-[3-amino-2-(benzhydrylideneamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate.
| Compound Name | [5-[3-amino-2-(benzhydrylideneamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 57034459 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [5-[3-amino-2-(benzhydrylideneamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate |
| SMILES | NC(=O)C(CC1CCCc2c(OC(=O)CO)cccc21)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O4/c29-28(33)24(30-27(19-9-3-1-4-10-19)20-11-5-2-6-12-20)17-21-13-7-15-23-22(21)14-8-16-25(23)34-26(32)18-31/h1-6,8-12,14,16,21,24,31H,7,13,15,17-18H2,(H2,29,33) |
| InChIKey | LNGDIOUNBIVWNG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|