C28H30N2O4 — CID 67758811
[5-[2-[(3-phenyl-3-pyridin-3-ylpropanoyl)amino]ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate (PubChem CID 67758811) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is [5-[2-[(3-phenyl-3-pyridin-3-ylpropanoyl)amino]ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate.
| Compound Name | [5-[2-[(3-phenyl-3-pyridin-3-ylpropanoyl)amino]ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 67758811 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | [5-[2-[(3-phenyl-3-pyridin-3-ylpropanoyl)amino]ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate |
| SMILES | O=C(CC(c1ccccc1)c1cccnc1)NCCC1CCCc2c(OC(=O)CO)cccc21 |
| InChI | InChI=1S/C28H30N2O4/c31-19-28(33)34-26-13-5-11-23-21(9-4-12-24(23)26)14-16-30-27(32)17-25(20-7-2-1-3-8-20)22-10-6-15-29-18-22/h1-3,5-8,10-11,13,15,18,21,25,31H,4,9,12,14,16-17,19H2,(H,30,32) |
| InChIKey | MJAXZZRQNHFFQT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|