C29H31NO4 — CID 67758630
[5-[3-(dibenzylamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate (PubChem CID 67758630) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is [5-[3-(dibenzylamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate.
| Compound Name | [5-[3-(dibenzylamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 67758630 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | [5-[3-(dibenzylamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl] 2-hydroxyacetate |
| SMILES | O=C(CO)Oc1cccc2c1CCCC2CCC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H31NO4/c31-21-29(33)34-27-16-8-14-25-24(13-7-15-26(25)27)17-18-28(32)30(19-22-9-3-1-4-10-22)20-23-11-5-2-6-12-23/h1-6,8-12,14,16,24,31H,7,13,15,17-21H2 |
| InChIKey | XKNQTAMQJLZYMV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|