C13H16O4 — CID 57046724
[1-(2-hydroxyethyl)-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate (PubChem CID 57046724) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is [1-(2-hydroxyethyl)-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate.
| Compound Name | [1-(2-hydroxyethyl)-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 57046724 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [1-(2-hydroxyethyl)-2,3-dihydro-1H-inden-4-yl] 2-hydroxyacetate |
| SMILES | O=C(CO)Oc1cccc2c1CCC2CCO |
| InChI | InChI=1S/C13H16O4/c14-7-6-9-4-5-11-10(9)2-1-3-12(11)17-13(16)8-15/h1-3,9,14-15H,4-8H2 |
| InChIKey | CFXXFULPNSOYTI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|