C23H38N2O7 — CID 57060381
1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2-(decanoylamino)pentanedioate (PubChem CID 57060381) has the molecular formula C23H38N2O7 and a molecular weight of 454.56 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2-(decanoylamino)pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2-(decanoylamino)pentanedioate |
|---|---|
| PubChem CID | 57060381 |
| Molecular Formula | C23H38N2O7 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2,5-dihydroxypyrrol-1-yl) (2S)-2-(decanoylamino)pentanedioate |
| SMILES | CCCCCCCCCC(=O)N[C@@H](CCC(=O)On1c(O)ccc1O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H38N2O7/c1-5-6-7-8-9-10-11-12-18(26)24-17(22(30)31-23(2,3)4)13-16-21(29)32-25-19(27)14-15-20(25)28/h14-15,17,27-28H,5-13,16H2,1-4H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | WNAIIUIRUIWPCW-KRWDZBQOSA-N |
| XLogP | 3.60 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|