C21H32ClN3OS — CID 57060411
3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propyl-cyclohexylcarbamothioic S-acid (PubChem CID 57060411) has the molecular formula C21H32ClN3OS and a molecular weight of 410.03 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propyl-cyclohexylcarbamothioic S-acid.
| Compound Name | 3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propyl-cyclohexylcarbamothioic S-acid |
|---|---|
| PubChem CID | 57060411 |
| Molecular Formula | C21H32ClN3OS |
| Molecular Weight | 410.03 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propyl-cyclohexylcarbamothioic S-acid |
| SMILES | O=C(S)N(CCCN1CCN(Cc2ccc(Cl)cc2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C21H32ClN3OS/c22-19-9-7-18(8-10-19)17-24-15-13-23(14-16-24)11-4-12-25(21(26)27)20-5-2-1-3-6-20/h7-10,20H,1-6,11-17H2,(H,26,27) |
| InChIKey | LSPWETJECDDTIJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.03 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|