C26H42Cl2N4O — CID 118692899
N-cyclohexyl-3-[2-(3,4-dichlorophenyl)ethylamino]-N-[2-(3-pyrrolidin-1-ylpropylamino)ethyl]propanamide (PubChem CID 118692899) has the molecular formula C26H42Cl2N4O and a molecular weight of 497.56 g/mol. Its IUPAC name is N-cyclohexyl-3-[2-(3,4-dichlorophenyl)ethylamino]-N-[2-(3-pyrrolidin-1-ylpropylamino)ethyl]propanamide.
| Compound Name | N-cyclohexyl-3-[2-(3,4-dichlorophenyl)ethylamino]-N-[2-(3-pyrrolidin-1-ylpropylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 118692899 |
| Molecular Formula | C26H42Cl2N4O |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | N-cyclohexyl-3-[2-(3,4-dichlorophenyl)ethylamino]-N-[2-(3-pyrrolidin-1-ylpropylamino)ethyl]propanamide |
| SMILES | O=C(CCNCCc1ccc(Cl)c(Cl)c1)N(CCNCCCN1CCCC1)C1CCCCC1 |
| InChI | InChI=1S/C26H42Cl2N4O/c27-24-10-9-22(21-25(24)28)11-14-30-15-12-26(33)32(23-7-2-1-3-8-23)20-16-29-13-6-19-31-17-4-5-18-31/h9-10,21,23,29-30H,1-8,11-20H2 |
| InChIKey | PXKIJHDHNLAQSA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|