C20H37N3O5 — CID 57060763
tert-butyl N-[4-carbamoyloxy-5-(4-ethylpiperidin-1-yl)-5-oxopentyl]-N-ethylcarbamate (PubChem CID 57060763) has the molecular formula C20H37N3O5 and a molecular weight of 399.53 g/mol. Its IUPAC name is tert-butyl N-[4-carbamoyloxy-5-(4-ethylpiperidin-1-yl)-5-oxopentyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[4-carbamoyloxy-5-(4-ethylpiperidin-1-yl)-5-oxopentyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 57060763 |
| Molecular Formula | C20H37N3O5 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | tert-butyl N-[4-carbamoyloxy-5-(4-ethylpiperidin-1-yl)-5-oxopentyl]-N-ethylcarbamate |
| SMILES | CCC1CCN(C(=O)C(CCCN(CC)C(=O)OC(C)(C)C)OC(N)=O)CC1 |
| InChI | InChI=1S/C20H37N3O5/c1-6-15-10-13-23(14-11-15)17(24)16(27-18(21)25)9-8-12-22(7-2)19(26)28-20(3,4)5/h15-16H,6-14H2,1-5H3,(H2,21,25) |
| InChIKey | KWHVDPUHBCHTAD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |