C19H34N2O5 — CID 91041439
2-(diethylcarbamoyl)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]butanoic acid (PubChem CID 91041439) has the molecular formula C19H34N2O5 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-(diethylcarbamoyl)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]butanoic acid.
| Compound Name | 2-(diethylcarbamoyl)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 91041439 |
| Molecular Formula | C19H34N2O5 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2-(diethylcarbamoyl)-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]butanoic acid |
| SMILES | CCN(CC)C(=O)C(CCC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)O |
| InChI | InChI=1S/C19H34N2O5/c1-6-20(7-2)16(22)15(17(23)24)9-8-14-10-12-21(13-11-14)18(25)26-19(3,4)5/h14-15H,6-13H2,1-5H3,(H,23,24) |
| InChIKey | UYPMUXSOSRCQHL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|