C34H47N3O5 — CID 57062868
benzyl N-[(2S)-2-amino-3-methylbutanoyl]-N-[(1R)-1-[tert-butyl(cyclohexanecarbonyl)amino]-2-oxo-4-phenylbutyl]carbamate (PubChem CID 57062868) has the molecular formula C34H47N3O5 and a molecular weight of 577.77 g/mol. Its IUPAC name is benzyl N-[(2S)-2-amino-3-methylbutanoyl]-N-[(1R)-1-[tert-butyl(cyclohexanecarbonyl)amino]-2-oxo-4-phenylbutyl]carbamate.
| Compound Name | benzyl N-[(2S)-2-amino-3-methylbutanoyl]-N-[(1R)-1-[tert-butyl(cyclohexanecarbonyl)amino]-2-oxo-4-phenylbutyl]carbamate |
|---|---|
| PubChem CID | 57062868 |
| Molecular Formula | C34H47N3O5 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.35 |
| IUPAC Name | benzyl N-[(2S)-2-amino-3-methylbutanoyl]-N-[(1R)-1-[tert-butyl(cyclohexanecarbonyl)amino]-2-oxo-4-phenylbutyl]carbamate |
| SMILES | CC(C)[C@H](N)C(=O)N(C(=O)OCc1ccccc1)[C@H](C(=O)CCc1ccccc1)N(C(=O)C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C34H47N3O5/c1-24(2)29(35)32(40)36(33(41)42-23-26-17-11-7-12-18-26)30(28(38)22-21-25-15-9-6-10-16-25)37(34(3,4)5)31(39)27-19-13-8-14-20-27/h6-7,9-12,15-18,24,27,29-30H,8,13-14,19-23,35H2,1-5H3/t29-,30-/m0/s1 |
| InChIKey | FKEHDOAFLSUHCF-KYJUHHDHSA-N |
| XLogP | 5.87 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|