C30H32N10O7 — CID 57063397
ethyl 2-[bis[2-[(3-nitro-2-pyridinyl)amino]ethyl]amino]-4-(4-carbamoylphenyl)-6-ethylpyrimidine-5-carboxylate (PubChem CID 57063397) has the molecular formula C30H32N10O7 and a molecular weight of 644.65 g/mol. Its IUPAC name is ethyl 2-[bis[2-[(3-nitro-2-pyridinyl)amino]ethyl]amino]-4-(4-carbamoylphenyl)-6-ethylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[bis[2-[(3-nitro-2-pyridinyl)amino]ethyl]amino]-4-(4-carbamoylphenyl)-6-ethylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 57063397 |
| Molecular Formula | C30H32N10O7 |
| Molecular Weight | 644.65 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | ethyl 2-[bis[2-[(3-nitro-2-pyridinyl)amino]ethyl]amino]-4-(4-carbamoylphenyl)-6-ethylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(CC)nc(N(CCNc2ncccc2[N+](=O)[O-])CCNc2ncccc2[N+](=O)[O-])nc1-c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C30H32N10O7/c1-3-21-24(29(42)47-4-2)25(19-9-11-20(12-10-19)26(31)41)37-30(36-21)38(17-15-34-27-22(39(43)44)7-5-13-32-27)18-16-35-28-23(40(45)46)8-6-14-33-28/h5-14H,3-4,15-18H2,1-2H3,(H2,31,41)(H,32,34)(H,33,35) |
| InChIKey | XULXWGFXVRCFRI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 234.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|