C18H17ClN2O6S — CID 57063519
benzylcarbamoyl 4-(4-chloro-3-sulfamoylphenyl)-4-oxobutanoate (PubChem CID 57063519) has the molecular formula C18H17ClN2O6S and a molecular weight of 424.86 g/mol. Its IUPAC name is benzylcarbamoyl 4-(4-chloro-3-sulfamoylphenyl)-4-oxobutanoate.
| Compound Name | benzylcarbamoyl 4-(4-chloro-3-sulfamoylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 57063519 |
| Molecular Formula | C18H17ClN2O6S |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | benzylcarbamoyl 4-(4-chloro-3-sulfamoylphenyl)-4-oxobutanoate |
| SMILES | NS(=O)(=O)c1cc(C(=O)CCC(=O)OC(=O)NCc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C18H17ClN2O6S/c19-14-7-6-13(10-16(14)28(20,25)26)15(22)8-9-17(23)27-18(24)21-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H,21,24)(H2,20,25,26) |
| InChIKey | CVJUMHSHUIDVCN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|