C11H12ClNO5S — CID 23329129
methyl 4-(4-chloro-3-sulfamoylphenyl)-4-oxobutanoate (PubChem CID 23329129) has the molecular formula C11H12ClNO5S and a molecular weight of 305.74 g/mol. Its IUPAC name is methyl 4-(4-chloro-3-sulfamoylphenyl)-4-oxobutanoate.
| Compound Name | methyl 4-(4-chloro-3-sulfamoylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 23329129 |
| Molecular Formula | C11H12ClNO5S |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | methyl 4-(4-chloro-3-sulfamoylphenyl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H12ClNO5S/c1-18-11(15)5-4-9(14)7-2-3-8(12)10(6-7)19(13,16)17/h2-3,6H,4-5H2,1H3,(H2,13,16,17) |
| InChIKey | HJNBAYMZRUACKM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |