C12H12Cl2O5S — CID 64637478
methyl 3-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfonylpropanoate (PubChem CID 64637478) has the molecular formula C12H12Cl2O5S and a molecular weight of 339.20 g/mol. Its IUPAC name is methyl 3-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfonylpropanoate.
| Compound Name | methyl 3-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfonylpropanoate |
|---|---|
| PubChem CID | 64637478 |
| Molecular Formula | C12H12Cl2O5S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | methyl 3-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfonylpropanoate |
| SMILES | COC(=O)CCS(=O)(=O)CC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2O5S/c1-19-12(16)4-5-20(17,18)7-11(15)8-2-3-9(13)10(14)6-8/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | HSYBVXMDOALFPC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |