C12H14Cl2O3S — CID 64637858
2-butylsulfonyl-1-(3,4-dichlorophenyl)ethanone (PubChem CID 64637858) has the molecular formula C12H14Cl2O3S and a molecular weight of 309.21 g/mol. Its IUPAC name is 2-butylsulfonyl-1-(3,4-dichlorophenyl)ethanone.
| Compound Name | 2-butylsulfonyl-1-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 64637858 |
| Molecular Formula | C12H14Cl2O3S |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2-butylsulfonyl-1-(3,4-dichlorophenyl)ethanone |
| SMILES | CCCCS(=O)(=O)CC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2O3S/c1-2-3-6-18(16,17)8-12(15)9-4-5-10(13)11(14)7-9/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | CKZMLQUUYJDRBW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |