C21H24N2O7 — CID 57063683
(2S)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-2-[(2-naphthalen-1-yloxyacetyl)amino]-4-oxobutanoic acid (PubChem CID 57063683) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is (2S)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-2-[(2-naphthalen-1-yloxyacetyl)amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-2-[(2-naphthalen-1-yloxyacetyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57063683 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (2S)-4-[(2S)-2-amino-3-methylbutanoyl]oxy-2-[(2-naphthalen-1-yloxyacetyl)amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)OC(=O)C[C@H](NC(=O)COc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H24N2O7/c1-12(2)19(22)21(28)30-18(25)10-15(20(26)27)23-17(24)11-29-16-9-5-7-13-6-3-4-8-14(13)16/h3-9,12,15,19H,10-11,22H2,1-2H3,(H,23,24)(H,26,27)/t15-,19-/m0/s1 |
| InChIKey | XXLXICGOTALDQQ-KXBFYZLASA-N |
| XLogP | 1.23 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|