C14H19N5O — CID 57063722
4-(butylamino)-1-[(3-methyl-2-pyridinyl)methyl]-1,3,5-triazin-2-one (PubChem CID 57063722) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-(butylamino)-1-[(3-methyl-2-pyridinyl)methyl]-1,3,5-triazin-2-one.
| Compound Name | 4-(butylamino)-1-[(3-methyl-2-pyridinyl)methyl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 57063722 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 4-(butylamino)-1-[(3-methyl-2-pyridinyl)methyl]-1,3,5-triazin-2-one |
| SMILES | CCCCNc1ncn(Cc2ncccc2C)c(=O)n1 |
| InChI | InChI=1S/C14H19N5O/c1-3-4-7-16-13-17-10-19(14(20)18-13)9-12-11(2)6-5-8-15-12/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,16,18,20) |
| InChIKey | OAONKIIBDSLPKH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|