C30H23N3O5 — CID 57064252
[3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethyl-3,9-dihydropyrrolo[3,2-b]carbazole-2-carboxylate (PubChem CID 57064252) has the molecular formula C30H23N3O5 and a molecular weight of 505.53 g/mol. Its IUPAC name is [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethyl-3,9-dihydropyrrolo[3,2-b]carbazole-2-carboxylate.
| Compound Name | [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethyl-3,9-dihydropyrrolo[3,2-b]carbazole-2-carboxylate |
|---|---|
| PubChem CID | 57064252 |
| Molecular Formula | C30H23N3O5 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | [3-[(4-nitrophenyl)methoxy]phenyl] 1,10-dimethyl-3,9-dihydropyrrolo[3,2-b]carbazole-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2cccc(OCc3ccc([N+](=O)[O-])cc3)c2)[nH]c2cc3c([nH]c4ccccc43)c(C)c12 |
| InChI | InChI=1S/C30H23N3O5/c1-17-27-18(2)29(32-26(27)15-24-23-8-3-4-9-25(23)31-28(17)24)30(34)38-22-7-5-6-21(14-22)37-16-19-10-12-20(13-11-19)33(35)36/h3-15,31-32H,16H2,1-2H3 |
| InChIKey | SZCOBSRMVHFWNL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|