C26H31N3O3 — CID 57064590
5-[5-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-pyrrol-2-yl]-N-[4-(dimethylamino)phenyl]pentanamide (PubChem CID 57064590) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 5-[5-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-pyrrol-2-yl]-N-[4-(dimethylamino)phenyl]pentanamide.
| Compound Name | 5-[5-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-pyrrol-2-yl]-N-[4-(dimethylamino)phenyl]pentanamide |
|---|---|
| PubChem CID | 57064590 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 5-[5-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-pyrrol-2-yl]-N-[4-(dimethylamino)phenyl]pentanamide |
| SMILES | CN(C)c1ccc(NC(=O)CCCCc2ccc(CC3COc4ccccc4O3)[nH]2)cc1 |
| InChI | InChI=1S/C26H31N3O3/c1-29(2)22-15-13-20(14-16-22)28-26(30)10-6-3-7-19-11-12-21(27-19)17-23-18-31-24-8-4-5-9-25(24)32-23/h4-5,8-9,11-16,23,27H,3,6-7,10,17-18H2,1-2H3,(H,28,30) |
| InChIKey | NCKRXIBKXLDHOX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|