C24H13ClF5N3O2 — CID 57065633
3-(4-chlorophenyl)-N-(2,2,3,3,7-pentafluoro-1-benzofuran-5-yl)-4-phenylpyrazole-1-carboxamide (PubChem CID 57065633) has the molecular formula C24H13ClF5N3O2 and a molecular weight of 505.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(2,2,3,3,7-pentafluoro-1-benzofuran-5-yl)-4-phenylpyrazole-1-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-(2,2,3,3,7-pentafluoro-1-benzofuran-5-yl)-4-phenylpyrazole-1-carboxamide |
|---|---|
| PubChem CID | 57065633 |
| Molecular Formula | C24H13ClF5N3O2 |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(2,2,3,3,7-pentafluoro-1-benzofuran-5-yl)-4-phenylpyrazole-1-carboxamide |
| SMILES | O=C(Nc1cc(F)c2c(c1)C(F)(F)C(F)(F)O2)n1cc(-c2ccccc2)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C24H13ClF5N3O2/c25-15-8-6-14(7-9-15)20-17(13-4-2-1-3-5-13)12-33(32-20)22(34)31-16-10-18-21(19(26)11-16)35-24(29,30)23(18,27)28/h1-12H,(H,31,34) |
| InChIKey | KJVGXRKUGYIJEY-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|