C25H16F5N3O2 — CID 56990733
4-(3-fluorophenyl)-3-(4-methylphenyl)-N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)pyrazole-1-carboxamide (PubChem CID 56990733) has the molecular formula C25H16F5N3O2 and a molecular weight of 485.41 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-3-(4-methylphenyl)-N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)pyrazole-1-carboxamide.
| Compound Name | 4-(3-fluorophenyl)-3-(4-methylphenyl)-N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 56990733 |
| Molecular Formula | C25H16F5N3O2 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 4-(3-fluorophenyl)-3-(4-methylphenyl)-N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)pyrazole-1-carboxamide |
| SMILES | Cc1ccc(-c2nn(C(=O)Nc3ccc4c(c3)C(F)(F)C(F)(F)O4)cc2-c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C25H16F5N3O2/c1-14-5-7-15(8-6-14)22-19(16-3-2-4-17(26)11-16)13-33(32-22)23(34)31-18-9-10-21-20(12-18)24(27,28)25(29,30)35-21/h2-13H,1H3,(H,31,34) |
| InChIKey | XUYRIVKEGISCMT-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|