C17H12F4N2O2 — CID 56690712
N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)-2,3-dihydroindole-1-carboxamide (PubChem CID 56690712) has the molecular formula C17H12F4N2O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 56690712 |
| Molecular Formula | C17H12F4N2O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)-2,3-dihydroindole-1-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(F)(F)C(F)(F)O2)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H12F4N2O2/c18-16(19)12-9-11(5-6-14(12)25-17(16,20)21)22-15(24)23-8-7-10-3-1-2-4-13(10)23/h1-6,9H,7-8H2,(H,22,24) |
| InChIKey | VXPPDNSRLRGIDC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|