C21H22N2O6 — CID 57065946
(4S)-4-benzyl-3-[(3S)-3-(3-methoxyphenyl)-4-nitrobutanoyl]-1,3-oxazolidin-2-one (PubChem CID 57065946) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(3S)-3-(3-methoxyphenyl)-4-nitrobutanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(3S)-3-(3-methoxyphenyl)-4-nitrobutanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 57065946 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (4S)-4-benzyl-3-[(3S)-3-(3-methoxyphenyl)-4-nitrobutanoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1cccc(C(CC(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)C[N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H22N2O6/c1-28-19-9-5-8-16(11-19)17(13-22(26)27)12-20(24)23-18(14-29-21(23)25)10-15-6-3-2-4-7-15/h2-9,11,17-18H,10,12-14H2,1H3/t17?,18-/m0/s1 |
| InChIKey | OBQMIUCGAZKWHW-ZVAWYAOSSA-N |
| XLogP | 3.04 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|