C18H24N2O5 — CID 175247262
4-benzyl-3-[5-methyl-3-(nitromethyl)hexanoyl]-1,3-oxazolidin-2-one (PubChem CID 175247262) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-benzyl-3-[5-methyl-3-(nitromethyl)hexanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[5-methyl-3-(nitromethyl)hexanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 175247262 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 4-benzyl-3-[5-methyl-3-(nitromethyl)hexanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)CC(CC(=O)N1C(=O)OCC1Cc1ccccc1)C[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N2O5/c1-13(2)8-15(11-19(23)24)10-17(21)20-16(12-25-18(20)22)9-14-6-4-3-5-7-14/h3-7,13,15-16H,8-12H2,1-2H3 |
| InChIKey | JCRJVGHTFVJLMO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|