C19H26N2O7 — CID 172684709
(4R)-4-(3,5-dimethoxyphenyl)-3-[(3S)-5-methyl-3-(nitromethyl)hexanoyl]-1,3-oxazolidin-2-one (PubChem CID 172684709) has the molecular formula C19H26N2O7 and a molecular weight of 394.42 g/mol. Its IUPAC name is (4R)-4-(3,5-dimethoxyphenyl)-3-[(3S)-5-methyl-3-(nitromethyl)hexanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-(3,5-dimethoxyphenyl)-3-[(3S)-5-methyl-3-(nitromethyl)hexanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 172684709 |
| Molecular Formula | C19H26N2O7 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (4R)-4-(3,5-dimethoxyphenyl)-3-[(3S)-5-methyl-3-(nitromethyl)hexanoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1cc(OC)cc([C@@H]2COC(=O)N2C(=O)C[C@H](CC(C)C)C[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H26N2O7/c1-12(2)5-13(10-20(24)25)6-18(22)21-17(11-28-19(21)23)14-7-15(26-3)9-16(8-14)27-4/h7-9,12-13,17H,5-6,10-11H2,1-4H3/t13-,17-/m0/s1 |
| InChIKey | AWMDIEFQYWONJX-GUYCJALGSA-N |
| XLogP | 3.05 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|