C31H28NO3P — CID 11477431
(4S)-4-benzyl-3-[(3R)-3-diphenylphosphanyl-3-phenylpropanoyl]-1,3-oxazolidin-2-one (PubChem CID 11477431) has the molecular formula C31H28NO3P and a molecular weight of 493.54 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(3R)-3-diphenylphosphanyl-3-phenylpropanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(3R)-3-diphenylphosphanyl-3-phenylpropanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11477431 |
| Molecular Formula | C31H28NO3P |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (4S)-4-benzyl-3-[(3R)-3-diphenylphosphanyl-3-phenylpropanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(C[C@H](c1ccccc1)P(c1ccccc1)c1ccccc1)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C31H28NO3P/c33-30(32-26(23-35-31(32)34)21-24-13-5-1-6-14-24)22-29(25-15-7-2-8-16-25)36(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,26,29H,21-23H2/t26-,29+/m0/s1 |
| InChIKey | ANVNAPWITOXGOX-LITSAYRRSA-N |
| XLogP | 5.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|