About ditert-butyl(diphenyl)-λ4-sulfane
ditert-butyl(diphenyl)-λ4-sulfane (PubChem CID 57066326) has the molecular formula C20H28S
and a molecular weight of 300.51 g/mol. Its IUPAC name is ditert-butyl(diphenyl)-λ4-sulfane.
Molecular Properties
| Compound Name | ditert-butyl(diphenyl)-λ4-sulfane |
| PubChem CID | 57066326 |
| Molecular Formula | C20H28S |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | ditert-butyl(diphenyl)-λ4-sulfane |
| SMILES | CC(C)(C)S(c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H28S/c1-19(2,3)21(20(4,5)6,17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16H,1-6H3 |
| InChIKey | CKDCXMOGHJDDQN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ditert-butyl(diphenyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl(diphenyl)-λ4-sulfane?
The IUPAC name of ditert-butyl(diphenyl)-λ4-sulfane (CID 57066326) is ditert-butyl(diphenyl)-λ4-sulfane.
What is the SMILES notation for ditert-butyl(diphenyl)-λ4-sulfane?
The canonical SMILES for ditert-butyl(diphenyl)-λ4-sulfane is CC(C)(C)S(c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of ditert-butyl(diphenyl)-λ4-sulfane?
The InChIKey is CKDCXMOGHJDDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28S/c1-19(2,3)21(20(4,5)6,17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16H,1-6H3.
What are the key properties of ditert-butyl(diphenyl)-λ4-sulfane?
ditert-butyl(diphenyl)-λ4-sulfane has a molecular weight of 300.51 g/mol, XLogP of 6.51, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl(diphenyl)-λ4-sulfane is sourced from PubChem (CID 57066326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).