C17H16F3NO2 — CID 57068225
2-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethenylamino]oxyethanol (PubChem CID 57068225) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is 2-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethenylamino]oxyethanol.
| Compound Name | 2-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethenylamino]oxyethanol |
|---|---|
| PubChem CID | 57068225 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethenylamino]oxyethanol |
| SMILES | C=C(NOCCO)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H16F3NO2/c1-12(21-23-11-10-22)13-2-4-14(5-3-13)15-6-8-16(9-7-15)17(18,19)20/h2-9,21-22H,1,10-11H2 |
| InChIKey | NBGIBCOHDIATFX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|