C24H32F3NO — CID 145378421
1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine;propan-1-ol (PubChem CID 145378421) has the molecular formula C24H32F3NO and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine;propan-1-ol.
| Compound Name | 1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine;propan-1-ol |
|---|---|
| PubChem CID | 145378421 |
| Molecular Formula | C24H32F3NO |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 1-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]ethenamine;propan-1-ol |
| SMILES | C=C(N)c1ccc(CCc2ccc(CCCC)cc2)c(C(F)(F)F)c1.CCCO |
| InChI | InChI=1S/C21H24F3N.C3H8O/c1-3-4-5-16-6-8-17(9-7-16)10-11-18-12-13-19(15(2)25)14-20(18)21(22,23)24;1-2-3-4/h6-9,12-14H,2-5,10-11,25H2,1H3;4H,2-3H2,1H3 |
| InChIKey | QSQZQGJBWIKZNB-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |