C15H23N3O5S — CID 57069387
2-[benzylsulfonyl(2-morpholin-4-ylethyl)amino]-N-hydroxyacetamide (PubChem CID 57069387) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-[benzylsulfonyl(2-morpholin-4-ylethyl)amino]-N-hydroxyacetamide.
| Compound Name | 2-[benzylsulfonyl(2-morpholin-4-ylethyl)amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 57069387 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[benzylsulfonyl(2-morpholin-4-ylethyl)amino]-N-hydroxyacetamide |
| SMILES | O=C(CN(CCN1CCOCC1)S(=O)(=O)Cc1ccccc1)NO |
| InChI | InChI=1S/C15H23N3O5S/c19-15(16-20)12-18(7-6-17-8-10-23-11-9-17)24(21,22)13-14-4-2-1-3-5-14/h1-5,20H,6-13H2,(H,16,19) |
| InChIKey | UJVRSWKRLRJTFM-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|