C40H51NO3Si — CID 57069727
N-benzyl-N-[(2S)-3-phenoxy-2-triethylsilyloxypropyl]-3-phenylmethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine (PubChem CID 57069727) has the molecular formula C40H51NO3Si and a molecular weight of 621.94 g/mol. Its IUPAC name is N-benzyl-N-[(2S)-3-phenoxy-2-triethylsilyloxypropyl]-3-phenylmethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine.
| Compound Name | N-benzyl-N-[(2S)-3-phenoxy-2-triethylsilyloxypropyl]-3-phenylmethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine |
|---|---|
| PubChem CID | 57069727 |
| Molecular Formula | C40H51NO3Si |
| Molecular Weight | 621.94 g/mol |
| Exact Mass | 621.36 |
| IUPAC Name | N-benzyl-N-[(2S)-3-phenoxy-2-triethylsilyloxypropyl]-3-phenylmethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-amine |
| SMILES | CC[Si](CC)(CC)O[C@H](COc1ccccc1)CN(Cc1ccccc1)C1CCCc2ccc(OCc3ccccc3)cc2C1 |
| InChI | InChI=1S/C40H51NO3Si/c1-4-45(5-2,6-3)44-40(32-43-38-23-14-9-15-24-38)30-41(29-33-17-10-7-11-18-33)37-22-16-21-35-25-26-39(28-36(35)27-37)42-31-34-19-12-8-13-20-34/h7-15,17-20,23-26,28,37,40H,4-6,16,21-22,27,29-32H2,1-3H3/t37?,40-/m0/s1 |
| InChIKey | YRDJBIRZOCCOSY-VVHXLKTESA-N |
| XLogP | 9.48 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.94 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|